C19H23F3N2O4S2 — CID 139559233
3-(butylamino)-2-phenoxy-5-(2,2,2-trifluoroethylsulfinylmethyl)benzenesulfonamide (PubChem CID 139559233) has the molecular formula C19H23F3N2O4S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 3-(butylamino)-2-phenoxy-5-(2,2,2-trifluoroethylsulfinylmethyl)benzenesulfonamide.
| Compound Name | 3-(butylamino)-2-phenoxy-5-(2,2,2-trifluoroethylsulfinylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 139559233 |
| Molecular Formula | C19H23F3N2O4S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-(butylamino)-2-phenoxy-5-(2,2,2-trifluoroethylsulfinylmethyl)benzenesulfonamide |
| SMILES | CCCCNc1cc(CS(=O)CC(F)(F)F)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C19H23F3N2O4S2/c1-2-3-9-24-16-10-14(12-29(25)13-19(20,21)22)11-17(30(23,26)27)18(16)28-15-7-5-4-6-8-15/h4-8,10-11,24H,2-3,9,12-13H2,1H3,(H2,23,26,27) |
| InChIKey | XKKVZCYFCMHSQS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|