C24H29N3O4S — CID 54029537
3-(butylamino)-5-[[(3-hydroxyphenyl)methylamino]methyl]-2-phenoxybenzenesulfonamide (PubChem CID 54029537) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-(butylamino)-5-[[(3-hydroxyphenyl)methylamino]methyl]-2-phenoxybenzenesulfonamide.
| Compound Name | 3-(butylamino)-5-[[(3-hydroxyphenyl)methylamino]methyl]-2-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 54029537 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-(butylamino)-5-[[(3-hydroxyphenyl)methylamino]methyl]-2-phenoxybenzenesulfonamide |
| SMILES | CCCCNc1cc(CNCc2cccc(O)c2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C24H29N3O4S/c1-2-3-12-27-22-14-19(17-26-16-18-8-7-9-20(28)13-18)15-23(32(25,29)30)24(22)31-21-10-5-4-6-11-21/h4-11,13-15,26-28H,2-3,12,16-17H2,1H3,(H2,25,29,30) |
| InChIKey | LEOZXRXJXJZTDL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|