C18H24N2O4S — CID 56975509
5-(hydroxymethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide (PubChem CID 56975509) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide.
| Compound Name | 5-(hydroxymethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 56975509 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5-(hydroxymethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide |
| SMILES | CCCCCNc1cc(CO)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-2-3-7-10-20-16-11-14(13-21)12-17(25(19,22)23)18(16)24-15-8-5-4-6-9-15/h4-6,8-9,11-12,20-21H,2-3,7,10,13H2,1H3,(H2,19,22,23) |
| InChIKey | VNSZQWXSTWNZFT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|