C22H22BrNO2S2 — CID 70573886
2-benzyl-5-(bromomethyl)-3-(2-phenylethylsulfanyl)benzenesulfonamide (PubChem CID 70573886) has the molecular formula C22H22BrNO2S2 and a molecular weight of 476.46 g/mol. Its IUPAC name is 2-benzyl-5-(bromomethyl)-3-(2-phenylethylsulfanyl)benzenesulfonamide.
| Compound Name | 2-benzyl-5-(bromomethyl)-3-(2-phenylethylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70573886 |
| Molecular Formula | C22H22BrNO2S2 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 2-benzyl-5-(bromomethyl)-3-(2-phenylethylsulfanyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(CBr)cc(SCCc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C22H22BrNO2S2/c23-16-19-14-21(27-12-11-17-7-3-1-4-8-17)20(22(15-19)28(24,25)26)13-18-9-5-2-6-10-18/h1-10,14-15H,11-13,16H2,(H2,24,25,26) |
| InChIKey | SHXIVWSEQXFMHV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|