C14H12F3NO2S2 — CID 144609504
2,3,5-trifluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide (PubChem CID 144609504) has the molecular formula C14H12F3NO2S2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide.
| Compound Name | 2,3,5-trifluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 144609504 |
| Molecular Formula | C14H12F3NO2S2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2,3,5-trifluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(F)c(SCCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C14H12F3NO2S2/c15-10-8-11(22(18,19)20)12(16)13(17)14(10)21-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,18,19,20) |
| InChIKey | ZLKGOTSSBQDEFS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|