C13H9F4NO2S2 — CID 71584328
4-benzylsulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 71584328) has the molecular formula C13H9F4NO2S2 and a molecular weight of 351.35 g/mol. Its IUPAC name is 4-benzylsulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-benzylsulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 71584328 |
| Molecular Formula | C13H9F4NO2S2 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-benzylsulfanyl-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(SCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C13H9F4NO2S2/c14-8-10(16)13(22(18,19)20)11(17)9(15)12(8)21-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,18,19,20) |
| InChIKey | OHXLGCSDOPKBOU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|