C22H18FN3O2S2 — CID 18463782
4-[2-benzylsulfanyl-5-(4-fluorophenyl)-1H-imidazol-4-yl]benzenesulfonamide (PubChem CID 18463782) has the molecular formula C22H18FN3O2S2 and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-[2-benzylsulfanyl-5-(4-fluorophenyl)-1H-imidazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[2-benzylsulfanyl-5-(4-fluorophenyl)-1H-imidazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18463782 |
| Molecular Formula | C22H18FN3O2S2 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 4-[2-benzylsulfanyl-5-(4-fluorophenyl)-1H-imidazol-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2nc(SCc3ccccc3)[nH]c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H18FN3O2S2/c23-18-10-6-16(7-11-18)20-21(17-8-12-19(13-9-17)30(24,27)28)26-22(25-20)29-14-15-4-2-1-3-5-15/h1-13H,14H2,(H,25,26)(H2,24,27,28) |
| InChIKey | IXRABACSOXSJOT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |