C32H22F4N4O2S2 — CID 70533081
2-[2-[[4,5-bis(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyloxy]ethoxysulfanyl]-4,5-bis(4-fluorophenyl)-1H-imidazole (PubChem CID 70533081) has the molecular formula C32H22F4N4O2S2 and a molecular weight of 634.68 g/mol. Its IUPAC name is 2-[2-[[4,5-bis(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyloxy]ethoxysulfanyl]-4,5-bis(4-fluorophenyl)-1H-imidazole.
| Compound Name | 2-[2-[[4,5-bis(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyloxy]ethoxysulfanyl]-4,5-bis(4-fluorophenyl)-1H-imidazole |
|---|---|
| PubChem CID | 70533081 |
| Molecular Formula | C32H22F4N4O2S2 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | 2-[2-[[4,5-bis(4-fluorophenyl)-1H-imidazol-2-yl]sulfanyloxy]ethoxysulfanyl]-4,5-bis(4-fluorophenyl)-1H-imidazole |
| SMILES | Fc1ccc(-c2nc(SOCCOSc3nc(-c4ccc(F)cc4)c(-c4ccc(F)cc4)[nH]3)[nH]c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C32H22F4N4O2S2/c33-23-9-1-19(2-10-23)27-28(20-3-11-24(34)12-4-20)38-31(37-27)43-41-17-18-42-44-32-39-29(21-5-13-25(35)14-6-21)30(40-32)22-7-15-26(36)16-8-22/h1-16H,17-18H2,(H,37,38)(H,39,40) |
| InChIKey | GZHCWKFFQRNPMW-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|