C23H15F5N2O2S — CID 12832380
4,5-bis(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-imidazole (PubChem CID 12832380) has the molecular formula C23H15F5N2O2S and a molecular weight of 478.44 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-imidazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-imidazole |
|---|---|
| PubChem CID | 12832380 |
| Molecular Formula | C23H15F5N2O2S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(Sc3c(F)c(F)c(F)c(F)c3F)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H15F5N2O2S/c1-31-13-7-3-11(4-8-13)20-21(12-5-9-14(32-2)10-6-12)30-23(29-20)33-22-18(27)16(25)15(24)17(26)19(22)28/h3-10H,1-2H3,(H,29,30) |
| InChIKey | FWSZSSSAMXTCES-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|