C24H22N2O2S — CID 12832321
4,5-bis(4-methoxyphenyl)-2-(4-methylphenyl)sulfanyl-1H-imidazole (PubChem CID 12832321) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-(4-methylphenyl)sulfanyl-1H-imidazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-(4-methylphenyl)sulfanyl-1H-imidazole |
|---|---|
| PubChem CID | 12832321 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-(4-methylphenyl)sulfanyl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(Sc3ccc(C)cc3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O2S/c1-16-4-14-21(15-5-16)29-24-25-22(17-6-10-19(27-2)11-7-17)23(26-24)18-8-12-20(28-3)13-9-18/h4-15H,1-3H3,(H,25,26) |
| InChIKey | FKWMJKPLHWEZQD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |