C17H17F3N2O4S2 — CID 130436232
3-[3-(benzylamino)-2,5,6-trifluoro-4-sulfamoylphenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 130436232) has the molecular formula C17H17F3N2O4S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 3-[3-(benzylamino)-2,5,6-trifluoro-4-sulfamoylphenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 3-[3-(benzylamino)-2,5,6-trifluoro-4-sulfamoylphenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 130436232 |
| Molecular Formula | C17H17F3N2O4S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 3-[3-(benzylamino)-2,5,6-trifluoro-4-sulfamoylphenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CC(CSc1c(F)c(F)c(S(N)(=O)=O)c(NCc2ccccc2)c1F)C(=O)O |
| InChI | InChI=1S/C17H17F3N2O4S2/c1-9(17(23)24)8-27-15-11(18)12(19)16(28(21,25)26)14(13(15)20)22-7-10-5-3-2-4-6-10/h2-6,9,22H,7-8H2,1H3,(H,23,24)(H2,21,25,26) |
| InChIKey | NVJIZKBFICKUNH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|