C9H11NO4S2 — CID 43454192
2-(2-sulfamoylphenyl)sulfanylpropanoic acid (PubChem CID 43454192) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(2-sulfamoylphenyl)sulfanylpropanoic acid.
| Compound Name | 2-(2-sulfamoylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43454192 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-(2-sulfamoylphenyl)sulfanylpropanoic acid |
| SMILES | CC(Sc1ccccc1S(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H11NO4S2/c1-6(9(11)12)15-7-4-2-3-5-8(7)16(10,13)14/h2-6H,1H3,(H,11,12)(H2,10,13,14) |
| InChIKey | GWEHGQSRGKKKOS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |