C28H25F3N2O5S2 — CID 118377776
2,3,6-trifluoro-5-[[(1R,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-(2-phenylethylsulfonyl)benzenesulfonamide (PubChem CID 118377776) has the molecular formula C28H25F3N2O5S2 and a molecular weight of 590.65 g/mol. Its IUPAC name is 2,3,6-trifluoro-5-[[(1R,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-(2-phenylethylsulfonyl)benzenesulfonamide.
| Compound Name | 2,3,6-trifluoro-5-[[(1R,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-(2-phenylethylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118377776 |
| Molecular Formula | C28H25F3N2O5S2 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | 2,3,6-trifluoro-5-[[(1R,2R)-2-hydroxy-1,2-diphenylethyl]amino]-4-(2-phenylethylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(S(=O)(=O)CCc2ccccc2)c(N[C@H](c2ccccc2)[C@H](O)c2ccccc2)c1F |
| InChI | InChI=1S/C28H25F3N2O5S2/c29-21-22(30)28(39(35,36)17-16-18-10-4-1-5-11-18)25(23(31)27(21)40(32,37)38)33-24(19-12-6-2-7-13-19)26(34)20-14-8-3-9-15-20/h1-15,24,26,33-34H,16-17H2,(H2,32,37,38)/t24-,26-/m1/s1 |
| InChIKey | JFMMXYPFFNDKOS-AOYPEHQESA-N |
| XLogP | 4.65 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|