C16H19NO — CID 10847700
2-amino-1,4-diphenylbutan-1-ol (PubChem CID 10847700) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-amino-1,4-diphenylbutan-1-ol.
| Compound Name | 2-amino-1,4-diphenylbutan-1-ol |
|---|---|
| PubChem CID | 10847700 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-amino-1,4-diphenylbutan-1-ol |
| SMILES | NC(CCc1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO/c17-15(12-11-13-7-3-1-4-8-13)16(18)14-9-5-2-6-10-14/h1-10,15-16,18H,11-12,17H2 |
| InChIKey | REKXQWYSZYSQNP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |