C20H16O2S2 — CID 54305778
2,5-bis(benzylsulfanyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 54305778) has the molecular formula C20H16O2S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2,5-bis(benzylsulfanyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(benzylsulfanyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 54305778 |
| Molecular Formula | C20H16O2S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2,5-bis(benzylsulfanyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(SCc2ccccc2)C(=O)C=C1SCc1ccccc1 |
| InChI | InChI=1S/C20H16O2S2/c21-17-12-20(24-14-16-9-5-2-6-10-16)18(22)11-19(17)23-13-15-7-3-1-4-8-15/h1-12H,13-14H2 |
| InChIKey | SHJNCXITOILYLZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|