C20H18FNO5S2 — CID 174559040
2-[3-fluoro-5-(2-phenylethyl)phenyl]-3-sulfamoylbenzenesulfonic acid (PubChem CID 174559040) has the molecular formula C20H18FNO5S2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[3-fluoro-5-(2-phenylethyl)phenyl]-3-sulfamoylbenzenesulfonic acid.
| Compound Name | 2-[3-fluoro-5-(2-phenylethyl)phenyl]-3-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174559040 |
| Molecular Formula | C20H18FNO5S2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2-[3-fluoro-5-(2-phenylethyl)phenyl]-3-sulfamoylbenzenesulfonic acid |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)O)c1-c1cc(F)cc(CCc2ccccc2)c1 |
| InChI | InChI=1S/C20H18FNO5S2/c21-17-12-15(10-9-14-5-2-1-3-6-14)11-16(13-17)20-18(28(22,23)24)7-4-8-19(20)29(25,26)27/h1-8,11-13H,9-10H2,(H2,22,23,24)(H,25,26,27) |
| InChIKey | TVILYWQCRGTJSS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|