C12H9BrFNO5S2 — CID 150494548
2-(3-bromo-4-fluorophenyl)-3-sulfamoylbenzenesulfonic acid (PubChem CID 150494548) has the molecular formula C12H9BrFNO5S2 and a molecular weight of 410.24 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-3-sulfamoylbenzenesulfonic acid.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-3-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 150494548 |
| Molecular Formula | C12H9BrFNO5S2 |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-3-sulfamoylbenzenesulfonic acid |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)O)c1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H9BrFNO5S2/c13-8-6-7(4-5-9(8)14)12-10(21(15,16)17)2-1-3-11(12)22(18,19)20/h1-6H,(H2,15,16,17)(H,18,19,20) |
| InChIKey | HWMYIZONUOLZLB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|