C12H8BrFN2O7S2 — CID 151310907
2-(2-bromo-6-fluoro-4-nitrophenyl)-3-sulfamoylbenzenesulfonic acid (PubChem CID 151310907) has the molecular formula C12H8BrFN2O7S2 and a molecular weight of 455.24 g/mol. Its IUPAC name is 2-(2-bromo-6-fluoro-4-nitrophenyl)-3-sulfamoylbenzenesulfonic acid.
| Compound Name | 2-(2-bromo-6-fluoro-4-nitrophenyl)-3-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 151310907 |
| Molecular Formula | C12H8BrFN2O7S2 |
| Molecular Weight | 455.24 g/mol |
| Exact Mass | 453.89 |
| IUPAC Name | 2-(2-bromo-6-fluoro-4-nitrophenyl)-3-sulfamoylbenzenesulfonic acid |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)O)c1-c1c(F)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C12H8BrFN2O7S2/c13-7-4-6(16(17)18)5-8(14)11(7)12-9(24(15,19)20)2-1-3-10(12)25(21,22)23/h1-5H,(H2,15,19,20)(H,21,22,23) |
| InChIKey | OEKNEGOEYFNTRN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|