C15H16FNO5S2 — CID 150255452
2-(3-fluoro-2-propan-2-ylphenyl)-3-sulfamoylbenzenesulfonic acid (PubChem CID 150255452) has the molecular formula C15H16FNO5S2 and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(3-fluoro-2-propan-2-ylphenyl)-3-sulfamoylbenzenesulfonic acid.
| Compound Name | 2-(3-fluoro-2-propan-2-ylphenyl)-3-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 150255452 |
| Molecular Formula | C15H16FNO5S2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-(3-fluoro-2-propan-2-ylphenyl)-3-sulfamoylbenzenesulfonic acid |
| SMILES | CC(C)c1c(F)cccc1-c1c(S(N)(=O)=O)cccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H16FNO5S2/c1-9(2)14-10(5-3-6-11(14)16)15-12(23(17,18)19)7-4-8-13(15)24(20,21)22/h3-9H,1-2H3,(H2,17,18,19)(H,20,21,22) |
| InChIKey | GALQIHYRCBUDFN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|