C20H22N2O4S2 — CID 21440213
cyanomethyl 4-benzyl-3-butylsulfanyl-5-sulfamoylbenzoate (PubChem CID 21440213) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is cyanomethyl 4-benzyl-3-butylsulfanyl-5-sulfamoylbenzoate.
| Compound Name | cyanomethyl 4-benzyl-3-butylsulfanyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 21440213 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | cyanomethyl 4-benzyl-3-butylsulfanyl-5-sulfamoylbenzoate |
| SMILES | CCCCSc1cc(C(=O)OCC#N)cc(S(N)(=O)=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O4S2/c1-2-3-11-27-18-13-16(20(23)26-10-9-21)14-19(28(22,24)25)17(18)12-15-7-5-4-6-8-15/h4-8,13-14H,2-3,10-12H2,1H3,(H2,22,24,25) |
| InChIKey | CJYAHZVNKYVGNU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|