C15H15N3O6S — CID 12591396
3-nitro-4-(2-phenylethylamino)-5-sulfamoylbenzoic acid (PubChem CID 12591396) has the molecular formula C15H15N3O6S and a molecular weight of 365.37 g/mol. Its IUPAC name is 3-nitro-4-(2-phenylethylamino)-5-sulfamoylbenzoic acid.
| Compound Name | 3-nitro-4-(2-phenylethylamino)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 12591396 |
| Molecular Formula | C15H15N3O6S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-nitro-4-(2-phenylethylamino)-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1NCCc1ccccc1 |
| InChI | InChI=1S/C15H15N3O6S/c16-25(23,24)13-9-11(15(19)20)8-12(18(21)22)14(13)17-7-6-10-4-2-1-3-5-10/h1-5,8-9,17H,6-7H2,(H,19,20)(H2,16,23,24) |
| InChIKey | YLHVPQFLGHZDTN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|