C13H10N2O7S — CID 46782493
3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid (PubChem CID 46782493) has the molecular formula C13H10N2O7S and a molecular weight of 343.33 g/mol. Its IUPAC name is 3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid.
| Compound Name | 3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 46782493 |
| Molecular Formula | C13H10N2O7S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(Oc2c([N+](=O)[O-])cc(C(=O)O)cc2S(N)(=O)=O)c([2H])c1[2H] |
| InChI | InChI=1S/C13H10N2O7S/c14-23(20,21)11-7-8(13(16)17)6-10(15(18)19)12(11)22-9-4-2-1-3-5-9/h1-7H,(H,16,17)(H2,14,20,21)/i1D,2D,3D,4D,5D |
| InChIKey | NXJUSSNAIUIVKY-RALIUCGRSA-N |
| XLogP | 1.73 |
| TPSA | 149.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|