C16H18N2O5S — CID 71315599
4-(2,3,4,5,6-pentadeuteriophenoxy)-3-(propylamino)-5-sulfamoylbenzoic acid (PubChem CID 71315599) has the molecular formula C16H18N2O5S and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentadeuteriophenoxy)-3-(propylamino)-5-sulfamoylbenzoic acid.
| Compound Name | 4-(2,3,4,5,6-pentadeuteriophenoxy)-3-(propylamino)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 71315599 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-(2,3,4,5,6-pentadeuteriophenoxy)-3-(propylamino)-5-sulfamoylbenzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(Oc2c(NCCC)cc(C(=O)O)cc2S(N)(=O)=O)c([2H])c1[2H] |
| InChI | InChI=1S/C16H18N2O5S/c1-2-8-18-13-9-11(16(19)20)10-14(24(17,21)22)15(13)23-12-6-4-3-5-7-12/h3-7,9-10,18H,2,8H2,1H3,(H,19,20)(H2,17,21,22)/i3D,4D,5D,6D,7D |
| InChIKey | YZACFNSGLDGBNP-DKFMXDSJSA-N |
| XLogP | 2.65 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |