C26H22N4O12S2 — CID 159284006
3-amino-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid;3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid (PubChem CID 159284006) has the molecular formula C26H22N4O12S2 and a molecular weight of 656.67 g/mol. Its IUPAC name is 3-amino-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid;3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid.
| Compound Name | 3-amino-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid;3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 159284006 |
| Molecular Formula | C26H22N4O12S2 |
| Molecular Weight | 656.67 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | 3-amino-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid;3-nitro-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid |
| SMILES | [2H]c1c([2H])c([2H])c(Oc2c(N)cc(C(=O)O)cc2S(N)(=O)=O)c([2H])c1[2H].[2H]c1c([2H])c([2H])c(Oc2c([N+](=O)[O-])cc(C(=O)O)cc2S(N)(=O)=O)c([2H])c1[2H] |
| InChI | InChI=1S/C13H10N2O7S.C13H12N2O5S/c14-23(20,21)11-7-8(13(16)17)6-10(15(18)19)12(11)22-9-4-2-1-3-5-9;14-10-6-8(13(16)17)7-11(21(15,18)19)12(10)20-9-4-2-1-3-5-9/h1-7H,(H,16,17)(H2,14,20,21);1-7H,14H2,(H,16,17)(H2,15,18,19)/i2*1D,2D,3D,4D,5D |
| InChIKey | KZGVLFSVHCLKMH-RKPNVICXSA-N |
| XLogP | 3.14 |
| TPSA | 282.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.67 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|