C17H17N3O7S — CID 21312078
4-(4-nitrophenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid (PubChem CID 21312078) has the molecular formula C17H17N3O7S and a molecular weight of 407.40 g/mol. Its IUPAC name is 4-(4-nitrophenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid.
| Compound Name | 4-(4-nitrophenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21312078 |
| Molecular Formula | C17H17N3O7S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 4-(4-nitrophenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(N2CCCC2)c1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N3O7S/c18-28(25,26)15-10-11(17(21)22)9-14(19-7-1-2-8-19)16(15)27-13-5-3-12(4-6-13)20(23)24/h3-6,9-10H,1-2,7-8H2,(H,21,22)(H2,18,25,26) |
| InChIKey | TWKAAIPUQCWJDU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 153.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|