C19H22N2O5S — CID 21312223
4-(2,4-dimethylphenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid (PubChem CID 21312223) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-(2,4-dimethylphenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid.
| Compound Name | 4-(2,4-dimethylphenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21312223 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-(2,4-dimethylphenoxy)-3-pyrrolidin-1-yl-5-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(Oc2c(N3CCCC3)cc(C(=O)O)cc2S(N)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-12-5-6-16(13(2)9-12)26-18-15(21-7-3-4-8-21)10-14(19(22)23)11-17(18)27(20,24)25/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,22,23)(H2,20,24,25) |
| InChIKey | QLZRCBUDGLBEFN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |