C20H24N2O5S — CID 21312130
3-(3,4-dimethylpyrrolidin-1-yl)-4-(4-methylphenoxy)-5-sulfamoylbenzoic acid (PubChem CID 21312130) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-(3,4-dimethylpyrrolidin-1-yl)-4-(4-methylphenoxy)-5-sulfamoylbenzoic acid.
| Compound Name | 3-(3,4-dimethylpyrrolidin-1-yl)-4-(4-methylphenoxy)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21312130 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-(3,4-dimethylpyrrolidin-1-yl)-4-(4-methylphenoxy)-5-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(Oc2c(N3CC(C)C(C)C3)cc(C(=O)O)cc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-12-4-6-16(7-5-12)27-19-17(22-10-13(2)14(3)11-22)8-15(20(23)24)9-18(19)28(21,25)26/h4-9,13-14H,10-11H2,1-3H3,(H,23,24)(H2,21,25,26) |
| InChIKey | BGJLFOMPCHAQGQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |