C22H28N2O5S — CID 16657769
3-methylbutyl 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoate (PubChem CID 16657769) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 3-methylbutyl 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoate.
| Compound Name | 3-methylbutyl 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16657769 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-methylbutyl 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzoate |
| SMILES | CC(C)CCOC(=O)c1cc(N2CCCC2)c(Oc2ccccc2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C22H28N2O5S/c1-16(2)10-13-28-22(25)17-14-19(24-11-6-7-12-24)21(20(15-17)30(23,26)27)29-18-8-4-3-5-9-18/h3-5,8-9,14-16H,6-7,10-13H2,1-2H3,(H2,23,26,27) |
| InChIKey | OIIASDPUPVUQDO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |