C17H18N2O4S — CID 11493978
5-formyl-2-phenoxy-3-pyrrolidin-1-ylbenzenesulfonamide (PubChem CID 11493978) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-formyl-2-phenoxy-3-pyrrolidin-1-ylbenzenesulfonamide.
| Compound Name | 5-formyl-2-phenoxy-3-pyrrolidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 11493978 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 5-formyl-2-phenoxy-3-pyrrolidin-1-ylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C=O)cc(N2CCCC2)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S/c18-24(21,22)16-11-13(12-20)10-15(19-8-4-5-9-19)17(16)23-14-6-2-1-3-7-14/h1-3,6-7,10-12H,4-5,8-9H2,(H2,18,21,22) |
| InChIKey | MXRYYQJMSYAKGD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|