C18H21N3O5S — CID 21312122
4-(4-aminophenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid (PubChem CID 21312122) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid.
| Compound Name | 4-(4-aminophenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21312122 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-(4-aminophenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid |
| SMILES | Nc1ccc(Oc2c(N3CCCCC3)cc(C(=O)O)cc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c19-13-4-6-14(7-5-13)26-17-15(21-8-2-1-3-9-21)10-12(18(22)23)11-16(17)27(20,24)25/h4-7,10-11H,1-3,8-9,19H2,(H,22,23)(H2,20,24,25) |
| InChIKey | FKGWFNHDOHESOG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|