C17H17N2O3S3- — CID 143445723
4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzenecarbodithioate (PubChem CID 143445723) has the molecular formula C17H17N2O3S3- and a molecular weight of 393.54 g/mol. Its IUPAC name is 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzenecarbodithioate.
| Compound Name | 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzenecarbodithioate |
|---|---|
| PubChem CID | 143445723 |
| Molecular Formula | C17H17N2O3S3- |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-phenoxy-3-pyrrolidin-1-yl-5-sulfamoylbenzenecarbodithioate |
| SMILES | NS(=O)(=O)c1cc(C(=S)[S-])cc(N2CCCC2)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3S3/c18-25(20,21)15-11-12(17(23)24)10-14(19-8-4-5-9-19)16(15)22-13-6-2-1-3-7-13/h1-3,6-7,10-11H,4-5,8-9H2,(H,23,24)(H2,18,20,21)/p-1 |
| InChIKey | QCRWFANPMZQPPI-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|