C19H22N2O6S — CID 21312206
4-(4-methoxyphenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid (PubChem CID 21312206) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid.
| Compound Name | 4-(4-methoxyphenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21312206 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 4-(4-methoxyphenoxy)-3-piperidin-1-yl-5-sulfamoylbenzoic acid |
| SMILES | COc1ccc(Oc2c(N3CCCCC3)cc(C(=O)O)cc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-26-14-5-7-15(8-6-14)27-18-16(21-9-3-2-4-10-21)11-13(19(22)23)12-17(18)28(20,24)25/h5-8,11-12H,2-4,9-10H2,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | XQQVFJNPNPJPMW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |