C14H24N2O2S — CID 60859949
3-[(heptylamino)methyl]benzenesulfonamide (PubChem CID 60859949) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 3-[(heptylamino)methyl]benzenesulfonamide.
| Compound Name | 3-[(heptylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60859949 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-[(heptylamino)methyl]benzenesulfonamide |
| SMILES | CCCCCCCNCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H24N2O2S/c1-2-3-4-5-6-10-16-12-13-8-7-9-14(11-13)19(15,17)18/h7-9,11,16H,2-6,10,12H2,1H3,(H2,15,17,18) |
| InChIKey | FHMLIKBJZUOBII-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|