C14H23BrN2O3S — CID 106054095
2-bromo-N-(4-methoxybutyl)-3-methyl-5-(methylaminomethyl)benzenesulfonamide (PubChem CID 106054095) has the molecular formula C14H23BrN2O3S and a molecular weight of 379.32 g/mol. Its IUPAC name is 2-bromo-N-(4-methoxybutyl)-3-methyl-5-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-(4-methoxybutyl)-3-methyl-5-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106054095 |
| Molecular Formula | C14H23BrN2O3S |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-bromo-N-(4-methoxybutyl)-3-methyl-5-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(C)c(Br)c(S(=O)(=O)NCCCCOC)c1 |
| InChI | InChI=1S/C14H23BrN2O3S/c1-11-8-12(10-16-2)9-13(14(11)15)21(18,19)17-6-4-5-7-20-3/h8-9,16-17H,4-7,10H2,1-3H3 |
| InChIKey | UNWWTYPIPCVYAE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|