C15H25BrN2O2S — CID 106079464
2-bromo-3-methyl-5-(methylaminomethyl)-N-(2-methylpentan-2-yl)benzenesulfonamide (PubChem CID 106079464) has the molecular formula C15H25BrN2O2S and a molecular weight of 377.35 g/mol. Its IUPAC name is 2-bromo-3-methyl-5-(methylaminomethyl)-N-(2-methylpentan-2-yl)benzenesulfonamide.
| Compound Name | 2-bromo-3-methyl-5-(methylaminomethyl)-N-(2-methylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106079464 |
| Molecular Formula | C15H25BrN2O2S |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-bromo-3-methyl-5-(methylaminomethyl)-N-(2-methylpentan-2-yl)benzenesulfonamide |
| SMILES | CCCC(C)(C)NS(=O)(=O)c1cc(CNC)cc(C)c1Br |
| InChI | InChI=1S/C15H25BrN2O2S/c1-6-7-15(3,4)18-21(19,20)13-9-12(10-17-5)8-11(2)14(13)16/h8-9,17-18H,6-7,10H2,1-5H3 |
| InChIKey | UQDXRGJGRPCFRY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |