C9H15F2N3O4S — CID 106001528
N-[2-(2,2-difluoroethoxy)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 106001528) has the molecular formula C9H15F2N3O4S and a molecular weight of 299.30 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106001528 |
| Molecular Formula | C9H15F2N3O4S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]nc(CO)c1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C9H15F2N3O4S/c1-6-9(7(4-15)14-13-6)19(16,17)12-2-3-18-5-8(10)11/h8,12,15H,2-5H2,1H3,(H,13,14) |
| InChIKey | AAJHVFQVLLFGMK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|