C11H21N3O3S2 — CID 106002472
3-(hydroxymethyl)-5-methyl-N-(5-methylsulfanylpentyl)-1H-pyrazole-4-sulfonamide (PubChem CID 106002472) has the molecular formula C11H21N3O3S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-methyl-N-(5-methylsulfanylpentyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3-(hydroxymethyl)-5-methyl-N-(5-methylsulfanylpentyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106002472 |
| Molecular Formula | C11H21N3O3S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-(hydroxymethyl)-5-methyl-N-(5-methylsulfanylpentyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CSCCCCCNS(=O)(=O)c1c(CO)n[nH]c1C |
| InChI | InChI=1S/C11H21N3O3S2/c1-9-11(10(8-15)14-13-9)19(16,17)12-6-4-3-5-7-18-2/h12,15H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | LLLFFJIJHHNRKJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|