C11H14ClN3O3S2 — CID 106044308
N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 106044308) has the molecular formula C11H14ClN3O3S2 and a molecular weight of 335.84 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106044308 |
| Molecular Formula | C11H14ClN3O3S2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-3-(hydroxymethyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]nc(CO)c1S(=O)(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H14ClN3O3S2/c1-7-11(9(6-16)15-14-7)20(17,18)13-5-4-8-2-3-10(12)19-8/h2-3,13,16H,4-6H2,1H3,(H,14,15) |
| InChIKey | JVJWSPDVEXFXJL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |