C10H13ClN4O2S2 — CID 106034665
3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1-methylpyrazole-4-sulfonamide (PubChem CID 106034665) has the molecular formula C10H13ClN4O2S2 and a molecular weight of 320.83 g/mol. Its IUPAC name is 3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106034665 |
| Molecular Formula | C10H13ClN4O2S2 |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCCc2ccc(Cl)s2)c(N)n1 |
| InChI | InChI=1S/C10H13ClN4O2S2/c1-15-6-8(10(12)14-15)19(16,17)13-5-4-7-2-3-9(11)18-7/h2-3,6,13H,4-5H2,1H3,(H2,12,14) |
| InChIKey | UWSJQWSEXBCCHV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |