C13H15ClN2O3S2 — CID 106034891
5-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 106034891) has the molecular formula C13H15ClN2O3S2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 5-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106034891 |
| Molecular Formula | C13H15ClN2O3S2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 5-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(N)cc1S(=O)(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H15ClN2O3S2/c1-19-11-4-2-9(15)8-12(11)21(17,18)16-7-6-10-3-5-13(14)20-10/h2-5,8,16H,6-7,15H2,1H3 |
| InChIKey | YHNRZZBGYKEDDO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|