C13H25N3O3S2 — CID 106002480
1-(2-hydroxyethyl)-3,5-dimethyl-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide (PubChem CID 106002480) has the molecular formula C13H25N3O3S2 and a molecular weight of 335.50 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3,5-dimethyl-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-hydroxyethyl)-3,5-dimethyl-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106002480 |
| Molecular Formula | C13H25N3O3S2 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-(2-hydroxyethyl)-3,5-dimethyl-N-(5-methylsulfanylpentyl)pyrazole-4-sulfonamide |
| SMILES | CSCCCCCNS(=O)(=O)c1c(C)nn(CCO)c1C |
| InChI | InChI=1S/C13H25N3O3S2/c1-11-13(12(2)16(15-11)8-9-17)21(18,19)14-7-5-4-6-10-20-3/h14,17H,4-10H2,1-3H3 |
| InChIKey | SELXFRTYTLBKCF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|