C13H26N4O3S — CID 106054114
1-(3-aminopropyl)-N-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 106054114) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-(3-aminopropyl)-N-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 1-(3-aminopropyl)-N-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106054114 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-(3-aminopropyl)-N-(4-methoxybutyl)-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | COCCCCNS(=O)(=O)c1c(C)nn(CCCN)c1C |
| InChI | InChI=1S/C13H26N4O3S/c1-11-13(12(2)17(16-11)9-6-7-14)21(18,19)15-8-4-5-10-20-3/h15H,4-10,14H2,1-3H3 |
| InChIKey | GBPPRFLSNSJHSW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|