C9H12F2N2O4S — CID 114128815
N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 114128815) has the molecular formula C9H12F2N2O4S and a molecular weight of 282.27 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114128815 |
| Molecular Formula | C9H12F2N2O4S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NCCOCC(F)F)c[nH]1 |
| InChI | InChI=1S/C9H12F2N2O4S/c10-8(11)6-17-4-3-13-18(15,16)7-1-2-9(14)12-5-7/h1-2,5,8,13H,3-4,6H2,(H,12,14) |
| InChIKey | WZWZZNBZUHAMHP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|