C9H11F3N2O3S — CID 115521683
6-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-3-sulfonamide (PubChem CID 115521683) has the molecular formula C9H11F3N2O3S and a molecular weight of 284.26 g/mol. Its IUPAC name is 6-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-3-sulfonamide.
| Compound Name | 6-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115521683 |
| Molecular Formula | C9H11F3N2O3S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 6-oxo-N-(4,4,4-trifluorobutyl)-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NCCCC(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C9H11F3N2O3S/c10-9(11,12)4-1-5-14-18(16,17)7-2-3-8(15)13-6-7/h2-3,6,14H,1,4-5H2,(H,13,15) |
| InChIKey | QSNQQSZVSDWISX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|