C10H14F3NO4S2 — CID 106433633
4-(hydroxymethyl)-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide (PubChem CID 106433633) has the molecular formula C10H14F3NO4S2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide.
| Compound Name | 4-(hydroxymethyl)-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide |
|---|---|
| PubChem CID | 106433633 |
| Molecular Formula | C10H14F3NO4S2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 4-(hydroxymethyl)-2,5-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]furan-3-sulfonamide |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCSC(F)(F)F)c1CO |
| InChI | InChI=1S/C10H14F3NO4S2/c1-6-8(5-15)9(7(2)18-6)20(16,17)14-3-4-19-10(11,12)13/h14-15H,3-5H2,1-2H3 |
| InChIKey | ANUDTUHUXNAGEZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|