C11H19NO5S — CID 114132079
N-(2-ethoxyethyl)-4-(hydroxymethyl)-2,5-dimethylfuran-3-sulfonamide (PubChem CID 114132079) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-4-(hydroxymethyl)-2,5-dimethylfuran-3-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-4-(hydroxymethyl)-2,5-dimethylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 114132079 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-(2-ethoxyethyl)-4-(hydroxymethyl)-2,5-dimethylfuran-3-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1c(C)oc(C)c1CO |
| InChI | InChI=1S/C11H19NO5S/c1-4-16-6-5-12-18(14,15)11-9(3)17-8(2)10(11)7-13/h12-13H,4-7H2,1-3H3 |
| InChIKey | JJZPEOMBWRWZNJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|