C10H17NO4S2 — CID 114132067
N-(2-ethoxyethyl)-5-(hydroxymethyl)-4-methylthiophene-2-sulfonamide (PubChem CID 114132067) has the molecular formula C10H17NO4S2 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-(hydroxymethyl)-4-methylthiophene-2-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-5-(hydroxymethyl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114132067 |
| Molecular Formula | C10H17NO4S2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-(2-ethoxyethyl)-5-(hydroxymethyl)-4-methylthiophene-2-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1cc(C)c(CO)s1 |
| InChI | InChI=1S/C10H17NO4S2/c1-3-15-5-4-11-17(13,14)10-6-8(2)9(7-12)16-10/h6,11-12H,3-5,7H2,1-2H3 |
| InChIKey | VQYCDKGMNGUGKU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|