C11H19NO3S2 — CID 114132191
5-(hydroxymethyl)-4-methyl-N-(2-methylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 114132191) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-methyl-N-(2-methylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-4-methyl-N-(2-methylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114132191 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 5-(hydroxymethyl)-4-methyl-N-(2-methylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCC(C)(C)NS(=O)(=O)c1cc(C)c(CO)s1 |
| InChI | InChI=1S/C11H19NO3S2/c1-5-11(3,4)12-17(14,15)10-6-8(2)9(7-13)16-10/h6,12-13H,5,7H2,1-4H3 |
| InChIKey | FNSIMDGTAMDGTC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |