C12H20N2O3S3 — CID 106327348
5-(hydroxymethyl)-4-methyl-N-(2-thiomorpholin-4-ylethyl)thiophene-2-sulfonamide (PubChem CID 106327348) has the molecular formula C12H20N2O3S3 and a molecular weight of 336.50 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-methyl-N-(2-thiomorpholin-4-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-4-methyl-N-(2-thiomorpholin-4-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106327348 |
| Molecular Formula | C12H20N2O3S3 |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 5-(hydroxymethyl)-4-methyl-N-(2-thiomorpholin-4-ylethyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCN2CCSCC2)sc1CO |
| InChI | InChI=1S/C12H20N2O3S3/c1-10-8-12(19-11(10)9-15)20(16,17)13-2-3-14-4-6-18-7-5-14/h8,13,15H,2-7,9H2,1H3 |
| InChIKey | WGJXIHUXPXPLLQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |