C11H16F3NO4S — CID 115522681
4-(hydroxymethyl)-2,5-dimethyl-N-(4,4,4-trifluorobutyl)furan-3-sulfonamide (PubChem CID 115522681) has the molecular formula C11H16F3NO4S and a molecular weight of 315.31 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,5-dimethyl-N-(4,4,4-trifluorobutyl)furan-3-sulfonamide.
| Compound Name | 4-(hydroxymethyl)-2,5-dimethyl-N-(4,4,4-trifluorobutyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 115522681 |
| Molecular Formula | C11H16F3NO4S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-(hydroxymethyl)-2,5-dimethyl-N-(4,4,4-trifluorobutyl)furan-3-sulfonamide |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCCC(F)(F)F)c1CO |
| InChI | InChI=1S/C11H16F3NO4S/c1-7-9(6-16)10(8(2)19-7)20(17,18)15-5-3-4-11(12,13)14/h15-16H,3-6H2,1-2H3 |
| InChIKey | KCLPOYJKEXAXRT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|